Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0090 |
| Product Name | Guaiazulene |
| CAS | 489-84-9 |
| Structure |  |
| Synonyms | 1,4-Dimethyl-7-(1-methylethyl)azulene |
| IUPAC Name | 1,4-dimethyl-7-propan-2-ylazulene |
| Molecular Weight | 198.3 g/mol |
| Molecular Formula | C15H18 |
| InChI | InChI=1S/C15H18/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h5-10H,1-4H3 |
| InChI Key | FWKQNCXZGNBPFD-UHFFFAOYSA-N |
| Boiling Point | 153 °C / 7mmHg |
| Melting Point | 27-29 °C |
| Purity | 95% |
| Density | 0.98 g/mL |
| Appearance | Low melting crystalline solid |
| Highest Usage In Residency Products | 0.0025 |
| Highest Usage In Rinsing Products | 0.005 |
| Isomeric SMILES | CC1=C2C=CC(=C2C=C(C=C1)C(C)C)C |
If you have any questions, please contact us. You will get a satisfactory answer.
