Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-BP-0012 |
| Product Name | Goralatide |
| CAS | 127103-11-1 |
| Structure |  |
| Synonyms | N-Ac-Ser-Asp-Lys-Pro-OH |
| IUPAC Name | 1-[2-[[2-[(2-acetamido-3-hydroxypropanoyl)amino]-3-carboxypropanoyl]amino]-6-aminohexanoyl]pyrrolidine-2-carboxylic acid |
| Molecular Weight | 487.5 g/mol |
| Molecular Formula | C20H33N5O9 |
| InChI | InChI=1S/C20H33N5O9/c1-11(27)22-14(10-26)18(31)24-13(9-16(28)29)17(30)23-12(5-2-3-7-21)19(32)25-8-4-6-15(25)20(33)34/h12-15,26H,2-10,21H2,1H3,(H,22,27)(H,23,30)(H,24,31)(H,28,29)(H,33,34) |
| InChI Key | HJDRXEQUFWLOGJ-UHFFFAOYSA-N |
| Appearance | White to off-white powder |
| Storage | -20 °C |
| Isomeric SMILES | CC(=O)NC(CO)C(=O)NC(CC(=O)O)C(=O)NC(CCCCN)C(=O)N1CCCC1C(=O)O |
What is the chemical name of the peptide referenced?
The chemical name of the peptide referenced is AC-SER-ASP-LYS-PRO-OH.
What are some synonyms for AC-SER-ASP-LYS-PRO-OH?
Some synonyms for AC-SER-ASP-LYS-PRO-OH include SERASPENIDE, ACETYL-SER-ASP-LYS-PRO, and AcSDKP.
What is the molecular formula of AC-SER-ASP-LYS-PRO-OH?
The molecular formula of AC-SER-ASP-LYS-PRO-OH is C20H33N5O9.
In what form does AC-SER-ASP-LYS-PRO-OH exist as at room temperature?
AC-SER-ASP-LYS-PRO-OH exists as a solid in a white to off-white color at room temperature.
What is the solubility of AC-SER-ASP-LYS-PRO-OH in DMSO?
AC-SER-ASP-LYS-PRO-OH is soluble in DMSO.
How does AcSDKP benefit the skin?
AcSDKP benefits the skin by stimulating the expression of proteins that strengthen tight junctions, accelerating skin healing, increasing collagen synthesis, and promoting cell longevity and hair growth.
How is AcSDKP catabolized in the body?
AcSDKP is catabolized almost exclusively by angiotensin converting enzyme I (ACEI).
What effect does AcSDKP have on gene expression regulated by TGFβ?
AcSDKP inhibits the phosphorylation of Smad2, downsizing the expression of genes regulated by TGFβ.
How does AcSDKP stimulate angiogenesis?
AcSDKP has been recognized as a potent inducer of angiogenesis in the skin.
What is the concentration range of AcSDKP that stimulates skin healing after UV irradiation in an ex vivo study?
AcSDKP at a concentration of 10-7-10-11 stimulates skin healing after UV irradiation in an ex vivo study.
If you have any questions, please contact us. You will get a satisfactory answer.
