Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1265 |
| Product Name | Glycyrrhizic Acid |
| CAS | 1405-86-3 |
| Structure |  |
| Synonyms | 18-Beta-glycyrrhizicacid |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-[(2S,3R,4S,5S,6S)-2-[[(3S,4aR,6aR,6bS,8aS,11S,12aR,14aR,14bS)-11-carboxy-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl]oxy]-6-carboxy-4,5-dihydroxyoxan-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Molecular Weight | 822.93 g/mol |
| Molecular Formula | C42H62O16 |
| InChI | InChI=1S/C42H62O16/c1-37(2)21-8-11-42(7)31(20(43)16-18-19-17-39(4,36(53)54)13-12-38(19,3)14-15-41(18,42)6)40(21,5)10-9-22(37)55-35-30(26(47)25(46)29(57-35)33(51)52)58-34-27(48)23(44)24(45)28(56-34)32(49)50/h16,19,21-31,34-35,44-48H,8-15,17H2,1-7H3,(H,49,50)(H,51,52)(H,53,54)/t19-,21-,22-,23-,24-,25-,26-,27+,28-,29-,30+,31+,34-,35-,38+,39-,40-,41+,42+/m0/s1 |
| InChI Key | LPLVUJXQOOQHMX-QWBHMCJMSA-N |
| Boiling Point | 681 °C |
| Melting Point | 220 °C |
| Purity | 95% |
| Density | 1.14 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.05 |
| Isomeric SMILES | C[C@]12CC[C@](C[C@H]1C3=CC(=O)[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O[C@@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)O)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)C(=O)O)O)O)O)C)(C)C(=O)O |
| pKa | 2.76±0.70 |
What is the chemical formula for Glycyrrhizic acid?
The chemical formula for Glycyrrhizic acid is C42H62O16.
What are some synonyms for Glycyrrhizic acid?
Some synonyms for Glycyrrhizic acid include Glycyrrhizic acid 1405-86-3, GLYCYRRHIZIN, and GLYCYRRHIZIC ACID.
What are some product categories that Glycyrrhizic acid falls under?
Some product categories that Glycyrrhizic acid falls under are Inhibitors, pharmaceutical intermediate, and standardized herbal extract.
What is the boiling point of Glycyrrhizic acid?
The boiling point of Glycyrrhizic acid is approximately 681.01°C.
What are some safety statements related to Glycyrrhizic acid?
Safety Statements related to Glycyrrhizic acid include 22-24/25, indicating that it should be kept away from skin and eyes.
What are some uses of Glycyrrhizic acid?
Glycyrrhizic acid is used as a flavorant and foaming agent, as well as for its anti-inflammatory, anti-ulcerous, and antiallergic effects.
What are some properties of Glycyrrhizic acid?
Glycyrrhizic acid is a white to off-white powder, has a bitter taste, and is used as a sweetening and flavoring agent in food.
What is the InChIKey for Glycyrrhizic acid?
The InChIKey for Glycyrrhizic acid is BXFBITNYMHAJGT-KYXJNIQISA-N.
What is the toxicity of Glycyrrhizic acid in humans?
The toxicity of Glycyrrhizic acid in humans is given as TDLo, oral, 5571ug/kg/3D.
How is Glycyrrhizic acid metabolized inside the body?
Inside the body, Glycyrrhizic acid can be metabolized to glycyrrhetinic acid, which inhibits enzymes related to corticosteroid metabolism.
If you have any questions, please contact us. You will get a satisfactory answer.
