Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0014 |
| Product Name | Glycine |
| CAS | 56-40-6 |
| Structure |  |
| Synonyms | 2-Aminoacetic acid;Gly;FEMA No. 3287 |
| IUPAC Name | 2-aminoacetic acid |
| Molecular Weight | 75.07 g/mol |
| Molecular Formula | C2H5NO2 |
| InChI | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5) |
| InChI Key | DHMQDGOQFOQNFH-UHFFFAOYSA-N |
| Melting Point | 240 °C |
| Purity | 95% |
| Density | 1.6 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.2027 |
| Isomeric SMILES | C(C(=O)O)N |
| pKa | 2.35 |
Glycine is a versatile amino acid recognized for its pivotal role in both skincare and hair care applications. As a fundamental component of collagen, it comprises approximately 35% of the collagen chain, contributing significantly to skin firmness and resilience. Beyond its structural importance, glycine acts as a natural moisturizing factor, enhancing the skin's ability to retain moisture and defend against dehydration. Moreover, its benefits extend to hair care, where it improves the smoothness and overall visual appeal of hair, facilitating a more effortless styling experience.
What is Glycine and why is it important?
Glycine is a small-molecule nonessential amino acid that plays a critical role as a proteinogenic amino acid. It is an essential precursor of collagen, which comprises approximately 35% glycine in its chain. Glycine provides firmness to the skin and is one of the natural moisturizing factors (NMFs), enhancing the skin's ability to retain moisture and protecting it from dehydration.
How does Glycine benefit the skin?
Glycine is crucial for skin health due to its role in collagen synthesis. As part of collagen, glycine contributes significantly to the firmness and elasticity of the skin. Additionally, as an essential natural moisturizing factor, glycine enhances the skin's moisture-binding capability, which helps avoid dehydration and maintains smooth, supple skin.
Can Glycine be used in hair care products?
Yes, glycine is well-suited for hair care products because it improves the smoothness of hair, especially noticeable when "finger-combed." It also enhances the overall aesthetics of hair, making it look healthier and more lustrous.
Why is Glycine considered a nonessential amino acid?
Glycine is classified as a nonessential amino acid because the human body can synthesize it on its own, meaning it is not strictly necessary to obtain it through diet. Despite this classification, glycine holds significant importance in various physiological processes, including the synthesis of collagen and other proteins.
In what ways does Glycine help maintain skin hydration?
Glycine helps maintain skin hydration through its function as a natural moisturizing factor. It enhances the skin's ability to bind moisture, thereby helping to prevent dehydration and maintain the skin's smooth texture and elasticity.
If you have any questions, please contact us. You will get a satisfactory answer.
