Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0140 |
| Product Name | Glyceryl Rosinate |
| CAS | 8050-31-5 |
| Synonyms | Resin acids and Rosin acids, esters with glycerol;FEMA No. 4226 |
| IUPAC Name | 2,3-dihydroxypropyl (1R,4aR,4bR,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,10,10a-octahydrophenanthrene-1-carboxylate |
| Molecular Weight | 376.5 g/mol |
| Molecular Formula | C23H36O4 |
| InChI | InChI=1S/C23H36O4/c1-15(2)16-6-8-19-17(12-16)7-9-20-22(19,3)10-5-11-23(20,4)21(26)27-14-18(25)13-24/h7,12,15,18-20,24-25H,5-6,8-11,13-14H2,1-4H3/t18?,19-,20+,22+,23+/m0/s1 |
| InChI Key | HBKBEZURJSNABK-MWJPAGEPSA-N |
| Purity | 95% |
| Density | 1.063 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.7399 |
| Highest Usage In Rinsing Products | 0.739 |
| Isomeric SMILES | CC(C)C1=CC2=CC[C@@H]3[C@@]([C@H]2CC1)(CCC[C@@]3(C)C(=O)OCC(CO)O)C |
What is Glyceryl Rosinate and how is it produced?
Glyceryl Rosinate, also known as GEGR (Glyceryl Ester of Gum Rosin) or ester gum, is a monoester of glycerol and mixed long-chain acids of rosin, also referred to as rosin acid or resin acid. It is produced through a specialized process that ensures product stability and maintains its quality over time. This compound is derived from the resin of pinewood and ranges in color from ruby red to black.
What are the primary uses and benefits of Glyceryl Rosinate in cosmetic products?
Glyceryl Rosinate is commonly used as an emulsifier and surfactant in personal care products. This means it effectively holds both oil and water phases together, providing a uniform and appealing appearance to the formulation. As a surfactant, it also helps produce foam, which is often perceived by consumers as an indicator of cleansing. Additionally, Glyceryl Rosinate is noted for its moisturizing properties and serves as a good film-former, creating an occlusive and protective film that helps the skin retain moisture, making it beneficial in addressing dry skin issues.
In what kind of products is Glyceryl Rosinate typically found?
Glyceryl Rosinate is widely used in personal care products, including depilatory or hair removal creams, and various cosmetic products. Its ability to emulsify, moisturize, and form a protective barrier makes it an ideal ingredient for these types of products, enhancing their performance and consumer appeal.
How does Glyceryl Rosinate enhance the consumer experience in personal care products?
Glyceryl Rosinate contributes to a more satisfying consumer experience by helping formulations maintain an appealing and uniform texture. Its ability to generate foam provides a sensory indication of cleanliness, which is valued in many cleansing products. Additionally, the moisturizing and protective barrier it provides helps improve skin condition, especially for individuals with dry skin, thus enhancing overall product efficacy and consumer satisfaction.
If you have any questions, please contact us. You will get a satisfactory answer.
