Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1184 |
| Product Name | Glyceryl Dioleate |
| CAS | 25637-84-7 |
| Structure |  |
| Synonyms | 9-Octadecenoic acid (9Z)-, diester with 1,2,3-propanetriol;9-Octadecenoic acid (Z)-, diester with 1,2,3-propanetriol;Dioleic acid, diester with glycerol |
| IUPAC Name | (2-hydroxy-3-octadec-9-enoyloxypropyl) octadec-9-enoate |
| Molecular Weight | 620.99 g/mol |
| Molecular Formula | C39H72O |
| InChI | InChI=1S/C39H72O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-35-37(40)36-44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,37,40H,3-16,21-36H2,1-2H3 |
| InChI Key | DRAWQKGUORNASA-UHFFFAOYSA-N |
| Melting Point | 12 °C |
| Purity | 95% |
| Density | 0.89-0.92 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.015 |
| Isomeric SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)O |
Glyceryl Dioleate, an ester derived from glycerin and oleic acid typically sourced from natural oil such as canola, serves as a versatile and oil-soluble emulsifier applicable in various sectors, including food and personal care. In personal care products, it functions as an emulsifier and lubricant, enhancing formulations by acting as a solubilizer and dispersant in creams and lotions. Additionally, Glyceryl Dioleate provides a smooth texture to creams, acts as a bath oil emollient, and serves as a spreading agent. This ingredient is also produced to comply with the Kosher standards established by the Orthodox Union (OU).
What is Glyceryl Dioleate, and what are its primary uses?
Glyceryl Dioleate is an ester derived from glycerin and oleic acid, typically sourced from natural edible sources such as canola oil. Its primary uses include acting as an emulsifier and lubricant in various applications across the food and personal care industries. Additionally, it serves as a solubilizer and dispersant in creams and lotions, contributing to improved texture and spreadability.
How is Glyceryl Dioleate utilized in personal care products?
In personal care products, Glyceryl Dioleate is used to impart "slip" to creams, enhancing their smoothness and ease of application. It is an effective emollient in bath oils and serves as a spreading agent, ensuring that products are evenly applied across the skin. The ingredient's role as an emulsifier and lubricant helps maintain consistent product quality and performance.
What industries benefit from the use of Glyceryl Dioleate?
Besides the personal care sector, Glyceryl Dioleate finds applications in the food industry as a multi-functional, oil-soluble emulsifier. Due to its versatile properties, it is used in various formulations where emulsification, lubrication, and enhanced spreadability are desired. Its compatibility with natural edible sources further broadens its applicability across different product categories.
If you have any questions, please contact us. You will get a satisfactory answer.
