Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1105 |
| Product Name | Glyceryl Dibehenate |
| CAS | 99880-64-5 |
| Structure |  |
| Synonyms | Docosanoic acid, diester with 1,2,3-propanetriol |
| IUPAC Name | docosanoic acid;propane-1,2,3-triol |
| Molecular Weight | 432.7 g/mol |
| Molecular Formula | C25H52O5 |
| InChI | InChI=1S/C22H44O2.C3H8O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;4-1-3(6)2-5/h2-21H2,1H3,(H,23,24);3-6H,1-2H2 |
| InChI Key | BYNVYIUJKRRNNC-UHFFFAOYSA-N |
| Melting Point | 50-52 °C |
| Purity | 95% |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.075 |
| Highest Usage In Rinsing Products | 0.08 |
| Isomeric SMILES | CCCCCCCCCCCCCCCCCCCCCC(=O)O.C(C(CO)O)O |
What is Glyceryl Dibehenate used for?
Glyceryl Dibehenate is a versatile fatty ester employed in various industries, including food, cosmetics, pharmaceuticals, and oral care. In the food industry, it serves as a formulation aid and a component of excipient formulations for tablets. In cosmetics, it is used to enhance the viscosity of oils and create gel-oil textures. In the pharmaceutical sector, it acts as an excipient in tablets and capsules and serves as a lubricant.
What are the properties of Glyceryl Dibehenate?
Glyceryl Dibehenate presents as a white, fluffy powder that is soluble in oils. It is known for its ability to improve the heat stability of balms and butters. Additionally, it functions as a skin-conditioning agent and emollient, providing beneficial moisturizing effects.
How is Glyceryl Dibehenate produced?
Glyceryl Dibehenate is produced through the esterification of glycerin with behenic (docosanoic) acid. The fatty acid used in this process can be derived from either vegetable or synthetic origins.
Why is Glyceryl Dibehenate used in pharmaceutical formulations?
In pharmaceuticals, Glyceryl Dibehenate is utilized due to its role as an excipient that aids in the formulation of tablets and capsules. Additionally, it acts as a lubricant which helps ensure the smooth processing and production of these dosage forms.
Can Glyceryl Dibehenate be used in natural or organic products?
Glyceryl Dibehenate can be included in natural and organic products, especially if the behenic acid used in its production is sourced from natural, plant-based origins. However, its compatibility with specific natural or organic product standards should be verified based on the origins of its components and the certification requirements.
If you have any questions, please contact us. You will get a satisfactory answer.
