Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-SC-1106 |
Product Name | Glyceryl Caprate |
CAS | 26402-22-2 |
Structure | ![]() |
Synonyms | Glyceryl caprate;Glyceryl monocaprate;Decanoic acid, monoester with glycerol |
IUPAC Name | 2,3-dihydroxypropyl decanoate |
Molecular Weight | 246.34 g/mol |
Molecular Formula | C13H26O4 |
InChI | InChI=1S/C13H26O4/c1-2-3-4-5-6-7-8-9-13(16)17-11-12(15)10-14/h12,14-15H,2-11H2,1H3 |
InChI Key | LKUNXBRZDFMZOK-UHFFFAOYSA-N |
Melting Point | 53 °C |
Purity | 95% |
Appearance | Solid |
Highest Usage In Residency Products | 0.08 |
Isomeric SMILES | CCCCCCCCCC(=O)OCC(CO)O |
What is the chemical formula for 1-Glyceryl caprate?
The chemical formula for 1-Glyceryl caprate is C13H26O4.
What are the synonyms for 1-Glyceryl caprate?
The synonyms for 1-Glyceryl caprate include GLYCERYL CAPRATE.
What is the CAS number for Glyceryl caprate?
The CAS number for 1-Glyceryl caprate is 26402-22-21.
What is the molecular weight of 1-Glyceryl caprate?
The molecular weight of 1-Glyceryl caprate is 246.34314.
What is the usage of glyceryl caprate?
Glyceryl caprate is used as an emollient and emulsifier that can be obtained from plants or synthetically manufactured.
What is the acyl group present in 1-monodecanoylglycerol?
The acyl group present in 1-monodecanoylglycerol is decanoyl (capryl).
Is 1-Glyceryl caprate a monoglyceride?
Yes, 1-Glyceryl caprate is a monoglyceride.
How can glyceryl caprate be obtained?
Glyceryl caprate can be obtained from plants or synthetically manufactured.
What is the chemical structure of 1-Glyceryl caprate?
The chemical structure of 1-Glyceryl caprate is a 1-monoglyceride with decanoyl as the acyl group.
What are some of the properties of glyceryl caprate that make it useful as an emollient and emulsifier?
Some properties of glyceryl caprate that make it useful as an emollient and emulsifier include its ability to soften and smooth the skin, as well as its ability to help mix oil and water-based ingredients.