Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0077 |
| Product Name | Glucuronic acid |
| CAS | 6556-12-3 |
| Structure |  |
| Synonyms | (2S,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid |
| IUPAC Name | (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| Molecular Weight | 194.14 g/mol |
| Molecular Formula | C6H10O7 |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/t2-,3+,4-,5-/m0/s1 |
| InChI Key | IAJILQKETJEXLJ-QTBDOELSSA-N |
| Boiling Point | 250.56 °C |
| Melting Point | 159-161 °C |
| Purity | 0.98 |
| Density | 1.43 g/mL |
| Solubility | Soluble in water |
| Appearance | White to off-white solid |
| Isomeric SMILES | C(=O)[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O)O)O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
