Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-FC-0042 |
| Product Name | Glucose |
| CAS | 5996-10-1 |
| Structure |  |
| Synonyms | D-Glucose monohydrate |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;hydrate |
| Molecular Weight | 198.17 g/mol |
| Molecular Formula | C6H14O7 |
| InChI | InChI=1S/C6H12O6.H2O/c7-1-3(9)5(11)6(12)4(10)2-8;/h1,3-6,8-12H,2H2;1H2/t3-,4+,5+,6+;/m0./s1 |
| InChI Key | SPFMQWBKVUQXJV-BTVCFUMJSA-N |
| Melting Point | 83 °C |
| Purity | 0.98 |
| Appearance | White solid |
| Isomeric SMILES | C([C@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O)O.O |
| pKa | 1.54 |
Glucose serves as a crucial energy source in skincare, utilized extensively for its moisturizing and probiotic benefits. As a small molecule sugar, glucose plays a fundamental role in maintaining skin hydration by attracting and retaining water molecules. It energizes key skin cells, such as keratinocytes and fibroblasts, by converting into ATP, thereby supporting their functions. Additionally, glucose has been shown to suppress melanogenesis in melanocytes, although the precise molecular mechanisms remain unclear. Researchers suggest the skin-whitening effect is mediated through the conversion of glucose to lactic acid by skin cells and microbiota, which subsequently inhibits tyrosinase activity and melanin synthesis. Practical applications have demonstrated both the efficacy and safety of glucose in cosmetic formulations.
What are the benefits of using glucose in skincare products?
Glucose is a small molecule sugar that serves as a universal energy source for skin cells, and it is widely used in skincare products for its moisturizing and probiotic effects. By capturing water molecules, glucose enhances the moisture-binding capacity of the skin, helping to maintain optimal hydration levels. Additionally, it provides energy for skin cells such as keratinocytes and fibroblasts, converting into ATP to energize and stimulate their functions.
How does glucose contribute to skin whitening?
Glucose is thought to have a skin whitening effect by indirectly suppressing melanogenesis in melanocytes. Although the precise molecular mechanism is not yet fully understood, it is hypothesized that skin cells and microbiota metabolize glucose into lactic acid. This process effectively suppresses tyrosinase activity, leading to the inhibition of melanin synthesis, resulting in a skin whitening effect.
Is glucose safe to use in skincare products?
Yes, the safety and effectiveness of glucose in skincare products have been proven practically. Glucose is a widely recognized cosmetic ingredient, valued for its ability to moisturize and energize skin cells without adverse effects.
Can glucose be used as a standalone moisturizer, or is it better combined with other skincare ingredients?
While glucose is effective in enhancing the skin's moisture-binding capacity by capturing water molecules, it is often used in combination with other skincare ingredients to maximize its benefits. This combination can lead to improved hydration and a comprehensive approach to skin health and appearance.
If you have any questions, please contact us. You will get a satisfactory answer.
