Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-BP-0193 |
| Product Name | GHK-Cu (acetate) |
| CAS | 300801-03-0 |
| Synonyms | [Glycyl-κN-L-histidyl-κN,κN3-L-lysinato(2-)]-Copper, monoacetate (9CI) |
| IUPAC Name | copper;acetic acid;(2S)-6-amino-2-[[(2S)-2-(2-aminoacetyl)azanidyl-3-(1H-imidazol-4-yl)propanoyl]amino]hexanoate |
| Molecular Weight | 460.96 g/mol |
| Molecular Formula | C16H25CuN6O6 |
| InChI | InChI=1S/C14H24N6O4.C2H4O2.Cu/c15-4-2-1-3-10(14(23)24)20-13(22)11(19-12(21)6-16)5-9-7-17-8-18-9;1-2(3)4;/h7-8,10-11H,1-6,15-16H2,(H4,17,18,19,20,21,22,23,24);1H3,(H,3,4);/q;;+2/p-2/t10-,11-;;/m0../s1 |
| InChI Key | NOIHSRSQDMJJFH-ULEGLUPFSA-L |
| Purity | 0.95 |
| Appearance | Solid |
| Isomeric SMILES | CC(=O)O.C1=C(N=CN1)C[C@@H](C(=O)N[C@@H](CCCCN)C(=O)[O-])[N-]C(=O)CN.[Cu+2] |
What is GHK-Cu (acetate) and how does it function?
GHK-Cu (acetate) is a complex consisting of the tripeptide Gly-His-Lys and a copper(II) ion. It is recognized for its properties in wound healing and anti-inflammatory activities. When applied, GHK-Cu stimulates increased proliferation and enhances the levels of collagen and pro-matrix metalloproteinase-2 (MMP-2) in human fibroblasts, promoting tissue repair and regeneration.
What are the benefits of using GHK-Cu in wound healing?
GHK-Cu has demonstrated significant benefits in wound healing. It increases the levels of collagen and glycosaminoglycans (GAGs), which are crucial for tissue strength and repair. Moreover, it enhances the expression of decorin, a protein vital for collagen organization in wound tissues, facilitating better healing outcomes.
How does GHK-Cu help with inflammation?
GHK-Cu exhibits potent anti-inflammatory properties. It decreases LPS-induced increases in reactive oxygen species (ROS), interleukin-6 (IL-6), and tumor necrosis factor-alpha (TNF-α) levels in cell models, thereby reducing inflammation and oxidative stress. This action is crucial in preventing tissue damage and promoting recovery in inflammatory conditions.
In what way does GHK-Cu affect oxidative stress in scenarios like acute lung injury?
GHK-Cu is effective in managing oxidative stress, specifically in acute lung injury scenarios. It prevents decreases in lung superoxide dismutase (SOD) activity and glutathione (GSH) levels, which are vital antioxidants in the body. Simultaneously, it reduces increases in cell numbers and total protein levels in bronchoalveolar lavage fluid, indicative of its protective effects against lung damage.
What concentration of GHK-Cu is typically used in research studies, and what are its effects?
Research studies commonly use GHK-Cu at concentrations like 1 nM or 10 µM, depending on the specific model and desired effects. At these concentrations, GHK-Cu has been observed to promote collagen production, reduce inflammatory markers, and manage oxidative stress, highlighting its efficacy in cellular and animal models for therapeutic exploration.
If you have any questions, please contact us. You will get a satisfactory answer.
