Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0068 |
| Product Name | Gallic Acid |
| CAS | 149-91-7 |
| Structure |  |
| Synonyms | 3,4,5-Trihydroxybezoic acid |
| IUPAC Name | 3,4,5-trihydroxybenzoic acid |
| Molecular Weight | 170.12 g/mol |
| Molecular Formula | C7H6O5 |
| InChI | InChI=1S/C7H6O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,8-10H,(H,11,12) |
| InChI Key | LNTHITQWFMADLM-UHFFFAOYSA-N |
| Boiling Point | 259.5 °C |
| Melting Point | 251 °C |
| Purity | 0.98 |
| Density | 1.7 g/mL |
| Appearance | Off-white solid |
| Highest Usage In Residency Products | 0.004 |
| Highest Usage In Rinsing Products | 0.03 |
| Isomeric SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)O |
| pKa | 4.41 |
If you have any questions, please contact us. You will get a satisfactory answer.
