Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0108 |
| Product Name | Galactaric Acid |
| CAS | 526-99-8 |
| Structure |  |
| Synonyms | Mucic acid |
| IUPAC Name | (2S,3R,4S,5R)-2,3,4,5-tetrahydroxyhexanedioic acid |
| Molecular Weight | 210.14 g/mol |
| Molecular Formula | C6H10O8 |
| InChI | InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2+,3+,4- |
| InChI Key | DSLZVSRJTYRBFB-DUHBMQHGSA-N |
| Boiling Point | 269.5 °C |
| Melting Point | 220-225 °C |
| Purity | 0.98 |
| Density | 1.527 g/mL |
| Appearance | White to off-white solid |
| Highest Usage In Residency Products | 0.003 |
| Isomeric SMILES | [C@@H]([C@@H]([C@H](C(=O)O)O)O)([C@@H](C(=O)O)O)O |
| pKa | 2.99±0.35 |
If you have any questions, please contact us. You will get a satisfactory answer.
