Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-0554 |
| Product Name | Fucoxanthin |
| CAS | 3351-86-8 |
| Structure |  |
| Synonyms | (3S,3'S,5R,5'R,6S,6'R)-6',7'-Didehydro-5,6-epoxy-4',5',6,7-tetrahydro-3,3',5'-trihydroxy-,-caroten-8(5H)-one |
| Description | Fucoxanthin is a naturally occurring compound found in brown seaweed, such as wakame, hijiki, and brown algae. It is a type of carotenoid and is known for its antioxidant properties. Fucoxanthin has been shown to have potential anti-inflammatory, anti-tumor, and anti-obesity effects. |
| IUPAC Name | [(1S,3R)-3-hydroxy-4-[(3E,5E,7E,9E,11E,13E,15E)-18-[(1R,3S,6S)-3-hydroxy-1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-6-yl]-3,7,12,16-tetramethyl-17-oxooctadeca-1,3,5,7,9,11,13,15-octaenylidene]-3,5,5-trimethylcyclohexyl] acetate |
| Molecular Weight | 658.9 g/mol |
| Molecular Formula | C42H58O6 |
| Canonical SMILES | CC(=CC=CC=C(C)C=CC=C(C)C(=O)CC12C(CC(CC1(O2)C)O)(C)C)C=CC=C(C)C=C=C3C(CC(CC3(C)O)OC(=O)C)(C)C |
| InChI | InChI=1S/C42H58O6/c1-29(18-14-19-31(3)22-23-37-38(6,7)26-35(47-33(5)43)27-40(37,10)46)16-12-13-17-30(2)20-15-21-32(4)36(45)28-42-39(8,9)24-34(44)25-41(42,11)48-42/h12-22,34-35,44,46H,24-28H2,1-11H3/b13-12+,18-14+,20-15+,29-16+,30-17+,31-19+,32-21+/t23,34-,35-,40+,41+,42-/m0/s1 |
| InChI Key | SJWWTRQNNRNTPU-ABBNZJFMSA-N |
| Boiling Point | 590.43 °C |
| Melting Point | 166-168 °C |
| Purity | 95%+ |
| Density | 1.09 g/mL |
| Solubility | Soluble in ethanol |
| Appearance | Powder |
| Application | 1. Fucoxanthin is a brown seaweed pigment that is used as a dietary supplement to promote weight loss. 2. It has anti-inflammatory properties and may help reduce the risk of chronic diseases such as cancer and heart disease. 3. Fucoxanthin may also have potential as a natural food preservative due to its antioxidant properties. 4. Studies have shown that fucoxanthin may improve insulin sensitivity and help regulate blood sugar levels. 5. It has been found to have antibacterial and antiviral properties and may be useful in the development of new treatments for infections. |
| Features And Benefits | 1. Has antioxidant properties and protects the skin from UV damage. 2. Has anti-inflammatory properties and soothes the skin. 3. Improves skin elasticity and firmness. 4. Reduces the appearance of fine lines and wrinkles. 5. Enhances skin hydration and moisture retention. |
| Isomeric SMILES | C/C(=C\C=C\C=C(/C)\C=C\C=C(/C)\C(=O)C[C@]12[C@](O1)(C[C@H](CC2(C)C)O)C)/C=C/C=C(\C)/C=C=C3[C@](C[C@H](CC3(C)C)OC(=O)C)(C)O |
| Refractive Index | n20/D 1.360-1.362 |
| Topological Polar Surface Area | 96.4 Ų |
What is fucoxanthin?
Fucoxanthin is a carotenoid produced by brown algae and diatoms.
What are some of the biological properties of fucoxanthin?
Fucoxanthin has antioxidant, anti-obesity, anti-diabetic, anticancer, and antimicrobial activities.
What was the aim of the study mentioned in the reference?
The aim of the study was to evaluate the antimicrobial activity of fucoxanthin against 20 bacterial species.
How was the antimicrobial effect of fucoxanthin determined in the study?
The antimicrobial effect of fucoxanthin was determined using the agar disc-diffusion and micro-dilution methods.
Which type of bacteria did fucoxanthin have a stronger impact on?
Fucoxanthin had a significantly stronger impact on Gram-positive bacteria compared to Gram-negative bacteria.
Which bacteria showed the highest activity of fucoxanthin according to the agar disc-diffusion method?
The highest activity of fucoxanthin was exhibited against Streptococcus agalactiae, Staphylococcus epidermidis, and Staphylococcus aureus.
What was the minimal inhibitory concentration (MIC) of fucoxanthin against Streptococcus agalactiae in the microdilution test?
The MIC of fucoxanthin against Streptococcus agalactiae was 62.5 µg/mL.
What other biological properties does fucoxanthin possess?
Fucoxanthin has a protective activity against oxidative stress, affects lipid metabolism, and possesses anti-obesity and anti-diabetic activities.
What other effects does fucoxanthin have on the cardiovascular system?
Fucoxanthin has been shown to decrease cholesterol and triacylglycerol levels, lower blood pressure, and reduce inflammatory processes.
If you have any questions, please contact us. You will get a satisfactory answer.
