Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0121 |
| Product Name | Farnesyl Acetate |
| CAS | 29548-30-9 |
| Structure |  |
| Synonyms | 2,6,1-Dodecatrien-1-ol, 3,7,11-trimethyl-, acetate;3,7,11-Trimethyldodeca-2,6,1-trienyl acetate |
| IUPAC Name | [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] acetate |
| Molecular Weight | 264.4 g/mol |
| Molecular Formula | C17H28O2 |
| InChI | InChI=1S/C17H28O2/c1-14(2)8-6-9-15(3)10-7-11-16(4)12-13-19-17(5)18/h8,10,12H,6-7,9,11,13H2,1-5H3/b15-10+,16-12+ |
| InChI Key | ZGIGZINMAOQWLX-NCZFFCEISA-N |
| Boiling Point | 115-125 °C / 0.3mmHg |
| Melting Point | 63-64 °C |
| Purity | 95% |
| Density | 0.914 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.0155 |
| Isomeric SMILES | CC(=CCC/C(=C/CC/C(=C/COC(=O)C)/C)/C)C |
What is the chemical formula for FARNESYL ACETATE?
The chemical formula for FARNESYL ACETATE is C17H28O2.
What is the molecular weight of FARNESYL ACETATE?
The molecular weight of FARNESYL ACETATE is 264.4.
What is the boiling point of FARNESYL ACETATE?
The boiling point of FARNESYL ACETATE is 115-125 °C at 0.3 mm Hg.
What is the odor of FARNESYL ACETATE described as?
The odor of FARNESYL ACETATE is described as a green floral orchid metallic cortex muguet waxy rose citrus scent.
In which natural products is FARNESYL ACETATE found?
FARNESYL ACETATE is reported to be found in thyme oil and ylang ylang oil CO2 extract.
What are some uses of FARNESYL ACETATE?
FARNESYL ACETATE is used as a tonic and for perfuming. It has also been noted to have beneficial effects on the skin's metabolic process and can help reduce sebum production in oily skin.
What is the aroma threshold value for FARNESYL ACETATE?
The aroma threshold value for FARNESYL ACETATE is described as medium strength odor, floral type.
What is the safety classification for FARNESYL ACETATE in WGK Germany?
FARNESYL ACETATE is classified as WGK Germany 3, which means it is considered hazardous to water.
What are some common synonyms for FARNESYL ACETATE?
Some common synonyms for FARNESYL ACETATE include FARNESYL ACETATE, CIS-TRANS- and (E,E)-3,7,11-TRIMETHYL-2,6,10-DODECATRIEN-1-OL ACETATE.
In what form is FARNESYL ACETATE commonly found?
FARNESYL ACETATE is commonly found as an oil in a colorless form.
If you have any questions, please contact us. You will get a satisfactory answer.
