Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-EO-0089 |
| Product Name | Eugenol |
| CAS | 97-53-0 |
| Structure |  |
| Synonyms | 4-Allyl-2-methoxy-pheno |
| IUPAC Name | 2-methoxy-4-prop-2-enylphenol |
| Molecular Weight | 164.2 g/mol |
| Molecular Formula | C10H12O2 |
| InChI | InChI=1S/C10H12O2/c1-3-4-8-5-6-9(11)10(7-8)12-2/h3,5-7,11H,1,4H2,2H3 |
| InChI Key | RRAFCDWBNXTKKO-UHFFFAOYSA-N |
| Boiling Point | 254 °C |
| Melting Point | -12~-10 °C |
| Purity | 0.98 |
| Density | 1.067 g/mL |
| Appearance | Liquid |
| Storage | 2-8°C |
| Isomeric SMILES | COC1=C(C=CC(=C1)CC=C)O |
If you have any questions, please contact us. You will get a satisfactory answer.
