Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0105 |
| Product Name | Etidronic Acid |
| CAS | 2809-21-4 |
| Structure |  |
| Synonyms | 1-Hydroxyethylidene-1,1-diphosphonic acid |
| IUPAC Name | (1-hydroxy-1-phosphonoethyl)phosphonic acid |
| Molecular Weight | 206.03 g/mol |
| Molecular Formula | C2H8O7P2 |
| InChI | InChI=1S/C2H8O7P2/c1-2(3,10(4,5)6)11(7,8)9/h3H,1H3,(H2,4,5,6)(H2,7,8,9) |
| InChI Key | DBVJJBKOTRCVKF-UHFFFAOYSA-N |
| Boiling Point | 578.8±60.0 °C |
| Melting Point | 198 °C |
| Purity | 95% |
| Density | 1.45 g/mL |
| Solubility | Soluble in water |
| Appearance | Solid |
| Isomeric SMILES | CC(O)(P(=O)(O)O)P(=O)(O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
