Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0200 |
| Product Name | Ethylparaben |
| CAS | 120-47-8 |
| Structure |  |
| Synonyms | Benzoic acid, 4-hydroxy-, ethyl ester;p-Hydroxybenzoic acid ethyl ester;Ethyl 4-hydroxybenzoate;Ethylparaben;Ethyl p-hydroxybenzoate;Ethyl paraben |
| IUPAC Name | ethyl 4-hydroxybenzoate |
| Molecular Weight | 166.17 g/mol |
| Molecular Formula | C9H10O3 |
| InChI | InChI=1S/C9H10O3/c1-2-12-9(11)7-3-5-8(10)6-4-7/h3-6,10H,2H2,1H3 |
| InChI Key | NUVBSKCKDOMJSU-UHFFFAOYSA-N |
| Boiling Point | 297-298 °C |
| Melting Point | 114-117 °C |
| Purity | 95% |
| Density | 1.17 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CCOC(=O)C1=CC=C(C=C1)O |
| pKa | 8.31±0.13 |
What is the chemical formula for Ethylparaben?
The chemical formula for Ethylparaben is C9H10O3.
What is the melting point of Ethylparaben?
The melting point of Ethylparaben is 114-117 °C.
How is Ethylparaben commonly used?
Ethylparaben is commonly used as antiseptics in cosmetics, food, and medicine.
What is the primary function of Ethylparaben in the formulation of cosmetics and personal care products?
Ethylparaben is used in formulations to extend shelf-life by preventing microbial contamination.
How is Ethylparaben prepared?
Ethylparaben is prepared by the esterification of p-hydroxybenzoic acid with ethanol (95%).
What is the safety information provided for Ethylparaben?
Ethylparaben is widely used as an antimicrobial preservative in cosmetics, food products, and pharmaceutical formulations but may cause hypersensitivity reactions.
How stable is Ethylparaben in aqueous solutions?
Aqueous Ethylparaben solutions at pH 3-6 are stable for up to about 4 years at room temperature.
What are some potential incompatibilities of Ethylparaben?
The antimicrobial properties of Ethylparaben are reduced in the presence of nonionic surfactants, can be absorbed by plastics, and is subject to hydrolysis by weak alkalis and strong acids.
What is the regulatory status of Ethylparaben?
Ethylparaben is accepted as a food additive in Europe, included in the FDA Inactive Ingredients Database, and included in nonparenteral medicines licensed in the UK.
What is the LD50 of Ethylparaben in oral administration to rabbits?
The LD50 of Ethylparaben orally in Rabbit is reported to be greater than 2000 mg/kg.
If you have any questions, please contact us. You will get a satisfactory answer.
