Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0153 |
| Product Name | Ethylhexyl Salicylate |
| CAS | 118-60-5 |
| Structure |  |
| Synonyms | 2-Ethylhexyl 2-hydroxybenzoate;2-Ethylhexyl salicylate;Benzoic acid, 2-hydroxy-, 2-ethylhexyl ester;Ethylhexyl salicylate |
| IUPAC Name | 2-ethylhexyl 2-hydroxybenzoate |
| Molecular Weight | 250.33 g/mol |
| Molecular Formula | C15H22O3 |
| InChI | InChI=1S/C15H22O3/c1-3-5-8-12(4-2)11-18-15(17)13-9-6-7-10-14(13)16/h6-7,9-10,12,16H,3-5,8,11H2,1-2H3 |
| InChI Key | FMRHJJZUHUTGKE-UHFFFAOYSA-N |
| Boiling Point | 189-190 °C / 21mmHg |
| Purity | 95% |
| Density | 1.01 g/mL |
| Appearance | Liquid |
| Isomeric SMILES | CCCCC(CC)COC(=O)C1=CC=CC=C1O |
| pKa | 8.13±0.30 |
What is the chemical formula of Ethylhexyl salicylate?
The chemical formula of Ethylhexyl salicylate is C15H22O3.
What is the boiling point of Ethylhexyl salicylate?
The boiling point of Ethylhexyl salicylate is 189-190 °C/21 mmHg.
What is the density of Ethylhexyl salicylate at 25 °C?
The density of Ethylhexyl salicylate is 1.014 g/mL at 25 °C.
Is Ethylhexyl salicylate soluble in Chloroform and Ethyl Acetate?
Yes, Ethylhexyl salicylate is slightly soluble in Chloroform and Ethyl Acetate.
What is the color and odor of Ethylhexyl salicylate?
Ethylhexyl salicylate is a colorless liquid with a mild orchid sweet balsam odor.
What is the water solubility of Ethylhexyl salicylate at 20°C?
The water solubility of Ethylhexyl salicylate is 74.4μg/L at 20°C.
What are some safety statements associated with the use of Ethylhexyl salicylate?
Safety statements for Ethylhexyl salicylate include 26-36/37/39.
What is the use of Ethylhexyl salicylate in cosmetic formulations?
Ethylhexyl salicylate is used as a UVB absorber in cosmetic formulations.
How is Ethylhexyl salicylate prepared?
Ethylhexyl salicylate is prepared from 2-ethylhexanol and salicylic acid by azeotropic-type esterification.
What are some brand names under which Ethylhexyl salicylate is sold?
Some brand names under which Ethylhexyl salicylate is sold include Escalol, Neo Heliopan, and Uvinul.
If you have any questions, please contact us. You will get a satisfactory answer.
