Our customer service representatives are available 24 hours a day, from Monday to Sunday.

Ethylhexyl Oleate

Online Inquiry

Catalog Number	CI-SC-1177
Product Name	Ethylhexyl Oleate
CAS	26399-02-0
Structure
Synonyms	2-Ethylhexyl oleate;9-Octadecenoic acid (Z)-, 2-ethylhexyl ester;Ethylhexyl oleate
IUPAC Name	2-ethylhexyl (Z)-octadec-9-enoate
Molecular Weight	394.7 g/mol
Molecular Formula	C26H50O2
InChI	InChI=1S/C26H50O2/c1-4-7-9-10-11-12-13-14-15-16-17-18-19-20-21-23-26(27)28-24-25(6-3)22-8-5-2/h14-15,25H,4-13,16-24H2,1-3H3/b15-14-
InChI Key	FOKDITTZHHDEHD-PFONDFGASA-N
Boiling Point	465.8±24.0 °C
Purity	95%
Density	0.87 g/mL
Appearance	Liquid
Isomeric SMILES	CCCCCCCC/C=C\CCCCCCCC(=O)OCC(CC)CCCC

Custom Q&A

What is the chemical formula for Ethylhexyl Oleate?

The chemical formula for Ethylhexyl Oleate is C26H50O2.

What is the molecular weight of Ethylhexyl Oleate?

The molecular weight of Ethylhexyl Oleate is 394.674.

What is the specific function of Ethylhexyl Oleate?

Ethylhexyl Oleate is commonly used as a cosmetic ingredient and emollient in skincare products.

How is Ethylhexyl Oleate commonly derived?

Ethylhexyl Oleate is typically derived from oleic acid and 2-ethylhexanol.

What are some potential uses of Ethylhexyl Oleate?

Ethylhexyl Oleate can be used as a solubilizer, emollient, and skin conditioning agent in various cosmetic formulations.

What are the benefits of using Ethylhexyl Oleate in skincare products?

Ethylhexyl Oleate helps to improve the texture and spreadability of skincare products, while also providing moisturizing and conditioning benefits to the skin.

Are there any known side effects or allergies associated with Ethylhexyl Oleate?

While Ethylhexyl Oleate is generally considered safe for use in cosmetics, individuals with sensitive skin may experience irritation or allergic reactions to this ingredient.

Online Inquiry