Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0068 |
| Product Name | Ethylhexyl Gallate |
| CAS | 34531-26-5 |
| Structure |  |
| Synonyms | 2-Ethylhexyl gallate |
| IUPAC Name | 2-ethylhexyl 3,4,5-trihydroxybenzoate |
| Molecular Weight | 282.33 g/mol |
| Molecular Formula | C15H22O5 |
| InChI | InChI=1S/C15H22O5/c1-3-5-6-10(4-2)9-20-15(19)11-7-12(16)14(18)13(17)8-11/h7-8,10,16-18H,3-6,9H2,1-2H3 |
| InChI Key | MTPIQEWGULCIPM-UHFFFAOYSA-N |
| Boiling Point | 476.5±40.0 °C |
| Density | 1.183 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CCCCC(CC)COC(=O)C1=CC(=C(C(=C1)O)O)O |
| pKa | 7.91±0.25 |
What is the chemical formula for 2-ethylhexyl gallate?
The chemical formula for 2-ethylhexyl gallate is C15H22O5.
What is the molecular weight of 2-ethylhexyl gallate?
The molecular weight of 2-ethylhexyl gallate is 282.33.
What is the CAS number for 2-ethylhexyl gallate?
The CAS number for 2-ethylhexyl gallate is 34531-26-5.
What are some synonyms for 2-ethylhexyl gallate?
Some synonyms for 2-ethylhexyl gallate include ETHYLHEXYL GALLATE, Benzoic acid, 3,4,5-trihydroxy-, 2-ethylhexyl ester, and 2-ethylhexyl 3,4,5-trihydroxybenzoate.
What is the predicted boiling point of 2-ethylhexyl gallate?
The predicted boiling point of 2-ethylhexyl gallate is 476.5±40.0 °C.
What is the predicted density of 2-ethylhexyl gallate?
The predicted density of 2-ethylhexyl gallate is 1.183±0.06 g/cm3.
What is the predicted pka value of 2-ethylhexyl gallate?
The predicted pka value of 2-ethylhexyl gallate is 7.91±0.25.
What is the estimated LogP value of 2-ethylhexyl gallate?
The estimated LogP value of 2-ethylhexyl gallate is 4.171.
What is the EPA Substance Registry System entry for 2-ethylhexyl gallate?
The EPA Substance Registry System entry for 2-ethylhexyl gallate is Benzoic acid, 3,4,5-trihydroxy-, 2-ethylhexyl ester (34531-26-5).
How is 2-ethylhexyl gallate commonly used in industries?
2-ethylhexyl gallate is commonly used as an antioxidant in industries such as food and cosmetics.
If you have any questions, please contact us. You will get a satisfactory answer.
