Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0106 |
| Product Name | Ethylenediaminetetraacetic Acid |
| CAS | 60-00-4 |
| Structure |  |
| Synonyms | EDTA, Ethylene Diamine Tetraacetic Acid, Edetic acid, Edetate, Titriplex 3, Titriplex III |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| Molecular Weight | 292.24 g/mol |
| Molecular Formula | C10H16N2O8 |
| InChI | InChI=1S/C10H16N2O8/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20) |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Boiling Point | 434 °C |
| Melting Point | 250 °C |
| Purity | 95% |
| Density | 1.46 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.05 |
| Isomeric SMILES | C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
