Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0037 |
| Product Name | Ethylbisiminomethylguaiacol Manganese Chloride |
| CAS | 81065-76-1 |
| Structure |  |
| Synonyms | Manganese (salen-3,3'-dimethoxy) chloride |
| IUPAC Name | manganese(3+);2-methoxy-6-[2-[(3-methoxy-2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;chloride |
| Molecular Weight | 416.74 g/mol |
| Molecular Formula | C18H18ClMnN2O4 |
| InChI | InChI=1S/C18H20N2O4.ClH.Mn/c1-23-15-7-3-5-13(17(15)21)11-19-9-10-20-12-14-6-4-8-16(24-2)18(14)22;;/h3-8,11-12,21-22H,9-10H2,1-2H3;1H;/q;;+3/p-3 |
| InChI Key | YUZJJFWCXJDFOQ-UHFFFAOYSA-K |
| Purity | 95% |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.01 |
| Isomeric SMILES | COC1=CC=CC(=C1[O-])C=NCCN=CC2=C(C(=CC=C2)OC)[O-].[Cl-].[Mn+3] |
What is the chemical name of EUK 134?
Ethylbisiminomethylguaiacol Manganese Chloride
What is the molecular formula of EUK 134?
C18H18ClMnN2O4
What is the molecular weight of EUK 134?
416.74
What is the storage temperature recommended for EUK 134?
-20°C
What are the biological activities associated with EUK 134?
It has exhibited potent antioxidant activities and inhibited the formation of β-amyloid and related amyloid fibrils.
How does EUK 134 protect the skin?
It protects the skin from pollution and other external aggressors, reduces the appearance of redness and UV damage such as pigmentation and dark spots.
What are some of the benefits of using EUK 134?
It acts as an antioxidant serum, protecting the skin and reducing the appearance of damage caused by pollution and UV exposure.
How does EUK 134 affect amyloid fibril formation?
It disrupts pre-formed amyloid fibrils and inhibits their formation.
What are the safety considerations for EUK 134?
It is classified as WGK Germany 3.
If you have any questions, please contact us. You will get a satisfactory answer.
