Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0193 |
| Product Name | 7-Ethylbicyclooxazolidine |
| CAS | 7747-35-5 |
| Structure |  |
| Synonyms | 1-Aza-5-ethyl-3,7-dioxabicyclo[3.3.0]octane |
| IUPAC Name | 7a-ethyl-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole |
| Molecular Weight | 143.18 g/mol |
| Molecular Formula | C7H13NO2 |
| InChI | InChI=1S/C7H13NO2/c1-2-7-3-9-5-8(7)6-10-4-7/h2-6H2,1H3 |
| InChI Key | ZRCMGIXRGFOXNT-UHFFFAOYSA-N |
| Boiling Point | 75 °C / 10mmHg |
| Purity | 95% |
| Density | 1.08 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CCC12COCN1COC2 |
If you have any questions, please contact us. You will get a satisfactory answer.
