Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1178 |
| Product Name | Ethyl Oleate |
| CAS | 111-62-6 |
| Structure |  |
| Synonyms | 9-Octadecenoic acid (9Z)-, ethyl ester;9-Octadecenoic acid, (Z)-, ethyl ester;Oleic acid, ethyl ester;FEMA No. 2450 |
| IUPAC Name | ethyl (Z)-octadec-9-enoate |
| Molecular Weight | 310.5 g/mol |
| Molecular Formula | C20H38O2 |
| InChI | InChI=1S/C20H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h11-12H,3-10,13-19H2,1-2H3/b12-11- |
| InChI Key | LVGKNOAMLMIIKO-QXMHVHEDSA-N |
| Boiling Point | 216-218 °C / 15mmHg |
| Melting Point | -32 °C |
| Purity | 95% |
| Density | 0.87 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.16 |
| Isomeric SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC |
Ethyl oleate, an ester derived from ethanol and oleic acid, is a versatile ingredient utilized widely in skincare and pharmaceutical formulations due to its multiple functional advantages. It remains in liquid form at room temperature with a refractive index of 1.45 and a specific gravity of 0.87. As a non-occlusive emollient, it provides excellent spreadability and is oil-soluble, making it suitable for products requiring a smooth, non-greasy application. Its low viscosity allows straightforward consistency control in formulations containing fixed oils. Moreover, ethyl oleate serves as an exceptional solvent for active ingredients in ointments, creams, and lotions, facilitating enhanced penetration in transdermal delivery systems. Its low chemical reactivity makes it suitable for sensitive skincare formulations, and it also functions effectively as a vehicle or diluent, replacing mineral or vegetable oils. The combination of its solvent and emollient properties contributes to improved aesthetics and usability of a wide range of topical products.
What is Ethyl Oleate, and what are its primary uses?
Ethyl Oleate is an ester formed from the reaction of ethanol and oleic acid (C18:1). It is a vegetable-based, non-animal origin ingredient commonly used in skincare and pharmaceutical formulations. Its primary functions include serving as a non-occlusive emollient, an excellent solvent for active ingredients, and a controlling agent for the consistency of formulas involving fixed oils.
What physical properties does Ethyl Oleate possess?
Ethyl Oleate is a liquid at 25°C, with a refractive index of 1.45 and a specific gravity of 0.87. It is known for its good spreading ability, lipophilic nature (oil-soluble), and excellent color profile. Additionally, due to its low viscosity, it is effective in adjusting the texture and feel of formulations, contributing to their ease of application.
How does Ethyl Oleate improve skincare and pharmaceutical formulations?
Ethyl Oleate enhances formulations by acting as an effective solvent for both active and inactive ingredients, particularly in ointments, creams, and lotions. It serves as an excipient in transdermal delivery systems, improving the penetration levels of active components. Its ability to form non-occlusive, well-spreading films enhances the aesthetic and application experience of creams and other topical products.
Is Ethyl Oleate suitable for all types of formulations?
Ethyl Oleate is suitable for replacing mineral or vegetable oils in various formulations, thanks to its low reactivity with chemically sensitive skincare actives. This makes it a versatile component across different skincare and pharmaceutical products, especially where a low-reactivity solvent is advantageous.
Can Ethyl Oleate affect the feel of skincare products?
Yes, Ethyl Oleate can significantly influence the texture and feel of skincare products. Its properties as a non-occlusive emollient with excellent spreading characteristics can improve the overall aesthetic and consumer experience. It helps manage the consistency and greasy feel of products, contributing to a more desirable skin application.
Why is Ethyl Oleate considered a beneficial ingredient in transdermal delivery systems?
Ethyl Oleate is beneficial in transdermal delivery systems due to its ability to enhance the penetration of active ingredients. Its role as an excipient allows for more efficient delivery of active compounds through the skin, optimizing the effectiveness of transdermal therapeutic products.
If you have any questions, please contact us. You will get a satisfactory answer.
