Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-SC-1181 |
Product Name | Ethyl Linolenate |
CAS | 1191-41-9 |
Structure | ![]() |
Synonyms | 9,12,15-Octadecatrienoic acid, ethyl ester, (9Z,12Z,15Z)-;9,12,15-Octadecatrienoic acid, ethyl ester, (Z,Z,Z)-;Ethyl (9Z,12Z,15Z)-9,12,15-octadecatrienoate |
IUPAC Name | ethyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
Molecular Weight | 306.5 g/mol |
Molecular Formula | C20H34O2 |
InChI | InChI=1S/C20H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h5-6,8-9,11-12H,3-4,7,10,13-19H2,1-2H3/b6-5-,9-8-,12-11- |
InChI Key | JYYFMIOPGOFNPK-AGRJPVHOSA-N |
Flash Point | 113 °C |
Purity | 95% |
Density | 0.89 g/mL |
Appearance | Oil |
Highest Usage In Residency Products | 0.0165 |
Isomeric SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OCC |
What is the chemical formula for LINOLENIC ACID ETHYL ESTER?
C20H34O2
What is the molecular weight of LINOLENIC ACID ETHYL ESTER?
306.48
What is the boiling point of LINOLENIC ACID ETHYL ESTER?
166-168 °C/1 mmHg
What is the color of LINOLENIC ACID ETHYL ESTER?
Colourless
What is the storage temperature recommended for LINOLENIC ACID ETHYL ESTER?
-20°C
What are the safety statements associated with LINOLENIC ACID ETHYL ESTER?
Safety Statements 24/25
What are the main uses of LINOLENIC ACID ETHYL ESTER?
It is used as an exogenous source of α-linolenic acid, as an emollient in indoor tanning preparations, and as a substrate in lipid peroxidation assays for antioxidant activity.
How does LINOLENIC ACID ETHYL ESTER inhibit the growth of certain microorganisms in vitro?
It inhibits the growth of S. mutans, C. albicans, and P. gingivalis by 98%, 72%, and 92% respectively.
What are some of the compatibility issues with LINOLENIC ACID ETHYL ESTER?
It is incompatible with strong oxidizers, strong acids, and strong bases.
Apart from being used as an emollient and in lipid peroxidation assays, what other potential use is being studied for Ethyl Linolenate?
It is being studied as a possible skin whitening agent with anti-melanogenesis activity.