Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1175 |
| Product Name | Ethyl Linoleate |
| CAS | 544-35-4 |
| Structure |  |
| Synonyms | 9,12-Octadecadienoic acid, (9Z,12Z)-, ethyl ester;9,12-Octadecadienoic acid, (Z,Z)-, ethyl ester;Linoleic acid, ethyl ester |
| IUPAC Name | ethyl (9Z,12Z)-octadeca-9,12-dienoate |
| Molecular Weight | 308.5 g/mol |
| Molecular Formula | C20H36O2 |
| InChI | InChI=1S/C20H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h8-9,11-12H,3-7,10,13-19H2,1-2H3/b9-8-,12-11- |
| InChI Key | FMMOOAYVCKXGMF-MURFETPASA-N |
| Boiling Point | 224 °C / 17mmHg |
| Melting Point | <25 °C |
| Flash Point | 110°C |
| Purity | 95% |
| Density | 0.87 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.03 |
| Isomeric SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OCC |
What is the chemical formula for Ethyl Linoleate?
The chemical formula for Ethyl Linoleate is C20H36O2.
What are some synonyms for Ethyl Linoleate?
Some synonyms for Ethyl Linoleate include Linoleic Acid Ethyl Ester, DELTA 9 CIS 12 OCTADECADIENOIC ACID ETHYL ESTER, and ETHYL (Z,Z)-9,12-OCTADECADIENOATE.
What is the molecular weight of Ethyl Linoleate?
The molecular weight of Ethyl Linoleate is 308.5.
What is the melting point of Ethyl Linoleate?
The melting point of Ethyl Linoleate is less than 25℃.
What is the boiling point of Ethyl Linoleate?
The boiling point of Ethyl Linoleate is 224 °C/17 mmHg.
What is the odor of Ethyl Linoleate described as?
The odor of Ethyl Linoleate is described as mild, fatty, fruity, and oily.
How is Ethyl Linoleate typically used in cosmetics?
Ethyl Linoleate is used in cosmetics for its anti-inflammatory properties, inhibiting the action of reactive oxygen species released by neutrophils.
How is Ethyl Linoleate used as a drying agent?
Ethyl Linoleate can be used as a drying agent for alkyd paints.
What is the safety information associated with Ethyl Linoleate?
Safety Statements 23-24/25 and WGK Germany 1 are associated with Ethyl Linoleate.
What physiological effects does Ethyl Linoleate have?
Ethyl Linoleate has anti-inflammatory properties and can prevent hyperkeratinization induced by a lack of linoleic acid.
If you have any questions, please contact us. You will get a satisfactory answer.
