Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0077 |
| Product Name | Erythorbic Acid |
| CAS | 89-65-6 |
| Structure |  |
| Synonyms | Isovitamin C;D-Isoascorbic acid;2,3-Didehydro-D-erythro-hexono-1,4-lactone |
| IUPAC Name | (2R)-2-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one |
| Molecular Weight | 176.12 g/mol |
| Molecular Formula | C6H8O6 |
| InChI | InChI=1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-10H,1H2/t2-,5-/m1/s1 |
| InChI Key | CIWBSHSKHKDKBQ-DUZGATOHSA-N |
| Boiling Point | 227.5 °C |
| Melting Point | 169-172 °C |
| Purity | 95% |
| Density | 1.37 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.01 |
| Highest Usage In Rinsing Products | 0.015 |
| Isomeric SMILES | C([C@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O |
| pKa | 4.09±0.10 |
If you have any questions, please contact us. You will get a satisfactory answer.
