Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0157 |
| Product Name | Drometrizole Trisiloxane |
| CAS | 155633-54-8 |
| Synonyms | Phenol,2-(2H-benzotriazol-2-yl)-4-methyl-6-(2-methyl-3-(1,3,3,3-tetramethyl-1-(trimethylsilyl)oxy)-disiloxanyl)propyl |
| IUPAC Name | 2-(benzotriazol-2-yl)-4-methyl-6-[2-methyl-3-[methyl-bis(trimethylsilyloxy)silyl]propyl]phenol |
| Molecular Weight | 501.8 g/mol |
| Molecular Formula | C24H39N3O3Si3 |
| InChI | InChI=1S/C24H39N3O3Si3/c1-18-14-20(15-19(2)17-33(9,29-31(3,4)5)30-32(6,7)8)24(28)23(16-18)27-25-21-12-10-11-13-22(21)26-27/h10-14,16,19,28H,15,17H2,1-9H3 |
| InChI Key | HUVYTMDMDZRHBN-UHFFFAOYSA-N |
| Boiling Point | 530.6±60.0 °C |
| Melting Point | 46-48 °C |
| Purity | 95% |
| Density | 1.06 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC1=CC(=C(C(=C1)N2N=C3C=CC=CC3=N2)O)CC(C)C[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| pKa | 8.36±0.50 |
If you have any questions, please contact us. You will get a satisfactory answer.
