Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0172 |
| Product Name | Drometrizole |
| CAS | 2440-22-4 |
| Structure |  |
| Synonyms | 2-(2H-Benzotriazol-2-yl)-p-cresol;Phenol, 2-(2H-benzotriazol-2-yl)-4-methyl- |
| IUPAC Name | 2-(benzotriazol-2-yl)-4-methylphenol |
| Molecular Weight | 225.25 g/mol |
| Molecular Formula | C13H11N3O |
| InChI | InChI=1S/C13H11N3O/c1-9-6-7-13(17)12(8-9)16-14-10-4-2-3-5-11(10)15-16/h2-8,17H,1H3 |
| InChI Key | MCPKSFINULVDNX-UHFFFAOYSA-N |
| Melting Point | 125.5-129.5 °C |
| Purity | 95% |
| Density | 1.38 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.001 |
| Highest Usage In Rinsing Products | 0.0012 |
| Isomeric SMILES | CC1=CC(=C(C=C1)O)N2N=C3C=CC=CC3=N2 |
What is the chemical formula for Drometrizole?
The chemical formula for Drometrizole is C13H11N3O.
What are some synonyms for Drometrizole?
Some synonyms for Drometrizole include Tinuvin P, LOTSORB UV P, and 2-(2-hydroxy-5-methylphenyl)-2H-benzotriazole.
What is the melting point of Drometrizole?
The melting point of Drometrizole is 125.5-129.5 °C.
What is the main application of Drometrizole?
Drometrizole is used as an ultraviolet protection agent in a wide variety of polymers.
What are some polymers that benefit from the use of Drometrizole for UV protection?
Polymers that benefit from the use of Drometrizole include styrene homo- and copolymers, polyesters, and polyvinyl chloride.
What are the features/benefits of Drometrizole?
Drometrizole has a strong absorption of ultraviolet radiation in the 300-400 nm region, high photostability, and the ability to release absorbed energy in non-sensitizing ways.
What are the guidelines for using Drometrizole in terms of concentration?
The use levels of Drometrizole range between 0.10% and 0.50%, depending on the substrate and performance requirements of the final application.
How does Drometrizole interact with heavy metal ions?
Drometrizole may react with heavy metal ions to form salts or complexes, such as colored complexes formed with iron or cobalt ions.
What is the safety advice regarding handling Drometrizole?
Drometrizole should be handled with care, skin should be protected, and contamination of the environment should be avoided. Dust formation and ignition sources should also be avoided.
What are some uses of Drometrizole besides UV protection in polymers?
Drometrizole is used as an intermediate reactant in the synthesis of UV light absorbers for polyester fibers and in the stabilization of plastics and organic materials against discoloration and deterioration.
If you have any questions, please contact us. You will get a satisfactory answer.
