Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0254 |
| Product Name | DM Hydantoin |
| CAS | 77-71-4 |
| Structure |  |
| Synonyms | 2,4-Imidazolidinedione, 5,5-dimethyl-;5,5-Dimethylhydantoin |
| IUPAC Name | 5,5-dimethylimidazolidine-2,4-dione |
| Molecular Weight | 128.13 g/mol |
| Molecular Formula | C5H8N2O2 |
| InChI | InChI=1S/C5H8N2O2/c1-5(2)3(8)6-4(9)7-5/h1-2H3,(H2,6,7,8,9) |
| InChI Key | YIROYDNZEPTFOL-UHFFFAOYSA-N |
| Boiling Point | 237.5 °C |
| Melting Point | 174-177 °C |
| Flash Point | 193°C |
| Purity | 95% |
| Density | 1.28 g/mL |
| Solubility | Soluble in water |
| Appearance | Solid |
| Isomeric SMILES | CC1(C(=O)NC(=O)N1)C |
If you have any questions, please contact us. You will get a satisfactory answer.
