Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0078 |
| Product Name | Disodium Tartrate |
| CAS | 868-18-8 |
| Structure |  |
| Synonyms | Butanedioic acid, 2,3-dihydroxy-, disodium salt |
| IUPAC Name | disodium;2,3-dihydroxybutanedioate |
| Molecular Weight | 194.05 g/mol |
| Molecular Formula | C4H4Na2O6 |
| InChI | InChI=1S/C4H6O6.2Na/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/q;2*+1/p-2 |
| InChI Key | HELHAJAZNSDZJO-UHFFFAOYSA-L |
| Purity | 95% |
| Density | 1.82 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C(C(C(=O)[O-])O)(C(=O)[O-])O.[Na+].[Na+] |
If you have any questions, please contact us. You will get a satisfactory answer.
