Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1311 |
| Product Name | Disodium Sebacate |
| CAS | 17265-14-4 |
| Structure |  |
| Synonyms | Decanedioic acid, sodium salt (1:2) |
| IUPAC Name | disodium;decanedioate |
| Molecular Weight | 246.21 g/mol |
| Molecular Formula | C10H16Na2O4 |
| InChI | InChI=1S/C10H18O4.2Na/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;;/h1-8H2,(H,11,12)(H,13,14);;/q;2*+1/p-2 |
| InChI Key | NCXUIEDQTCQZRK-UHFFFAOYSA-L |
| Purity | 98% |
| Density | 1.48 g/mL |
| Solubility | Soluble in water |
| Appearance | Solid |
| Isomeric SMILES | C(CCCCC(=O)[O-])CCCC(=O)[O-].[Na+].[Na+] |
If you have any questions, please contact us. You will get a satisfactory answer.
