Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0109 |
| Product Name | Disodium EDTA-Copper |
| CAS | 14025-15-1 |
| Structure |  |
| Synonyms | Copper disodium EDTA |
| IUPAC Name | copper;disodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate |
| Molecular Weight | 397.74 g/mol |
| Molecular Formula | C10H12CuN2Na2O8 |
| InChI | InChI=1S/C10H16N2O8.Cu.2Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;/q;+2;2*+1/p-4 |
| InChI Key | KCFCAUKZKOSSBI-UHFFFAOYSA-J |
| Purity | 95% |
| Density | 1.727 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.0028 |
| Isomeric SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Na+].[Cu+2] |
If you have any questions, please contact us. You will get a satisfactory answer.
