Our customer service representatives are available 24 hours a day, from Monday to Sunday.

Disodium EDTA

Online Inquiry
Catalog Number CI-OT-0048
Product Name Disodium EDTA
CAS 139-33-3
Structure
Synonyms Disodium EDTA
IUPAC Name disodium;2-[2-[carboxylatomethyl(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate
Molecular Weight 372.24 g/mol
Molecular Formula C10H14N2Na2O8
InChI InChI=1S/C10H16N2O8.2Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;/q;2*+1/p-2
InChI Key ZGTMUACCHSMWAC-UHFFFAOYSA-L
Melting Point 248 °C
Purity 95%
Density 1.01 g/mL
Solubility Miscible with water
Appearance Solid
Highest Usage In Residency Products 0.05
Isomeric SMILES C(CN(CC(=O)O)CC(=O)[O-])N(CC(=O)O)CC(=O)[O-].[Na+].[Na+]
Product Overview

Disodium EDTA, also known as Edetate disodium, is a multifunctional ingredient used in a variety of skincare products such as cleansers, masks, and creams. It serves as an effective stabilizing agent, enhances the shelf-life of formulations, and helps prevent undesirable reactions between other ingredients. As a potent anionic chelating agent, Disodium EDTA binds with metal ions such as calcium, nickel, chromium, and iron, which can accumulate on the skin's surface from exposure to urban dust, potentially impacting skin health. By forming stable metal-EDTA complexes, it prevents these metals from penetrating deeper skin layers, thereby minimizing adverse effects, particularly for individuals with sensitivities, such as nickel allergies. Additionally, by binding calcium on the skin's surface, Disodium EDTA intensifies the calcium gradient across skin layers, promoting cell renewal and providing an anti-aging benefit.

Custom Q&A

What is Disodium EDTA and how does it function in skincare products?

Disodium EDTA, also known as Edetate disodium, is a sodium salt derived from a water-soluble amino acid. It plays a crucial role in skincare formulations by acting as a stabilizing agent that enhances the shelf-life of products. Its primary function is to prevent reactions between different ingredients by binding metal ions (cations) such as Calcium, Nickel, Chromium, and Iron found on the skin's surface. This strong chelating action helps in creating stable metal-EDTA complexes, thereby inhibiting these metals' penetration into deeper skin layers.

How does Disodium EDTA benefit urban skin exposed to heavy metals?

Urban environments are prevalent with dust containing heavy metals, which can adversely affect skin health. Disodium EDTA mitigates these negative effects by forming stable complexes with such metals, effectively reducing their ability to penetrate into the skin. This property makes it particularly beneficial for individuals with sensitivities or allergies to specific metals, such as Nickel, which affects 10-20% of the U.S. population.

In what types of skincare products is Disodium EDTA typically used?

Disodium EDTA is commonly incorporated into a variety of skincare products, including cleansers, masks, and creams. Its inclusion in these formulations helps maintain product stability, prevent ingredient interaction, and safeguard the skin from environmental metal pollutants.

Does Disodium EDTA have any effects beyond metal chelation?

Yes, aside from its chelating capabilities, Disodium EDTA enhances the Calcium gradient between skin layers. By binding to Calcium on the skin's surface, it indirectly promotes cell renewal, leading to a potential anti-aging effect. This action can result in healthier, more youthful-looking skin over time.

Online Inquiry
Verification code