Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-0063 |
| Product Name | Dipropylene Glycol |
| CAS | 25265-71-8 |
| Structure |  |
| Synonyms | Oxydipropanol;Propanol, oxybis- |
| Description | Dipropylene glycol is a chemical compound that is often used as a solvent, humectant, and plasticizer. It is a colorless, odorless, and slightly viscous liquid with a low volatility and a high boiling point. This chemical is used in a wide range of products, including personal care products, such as cosmetics, lotions, and shampoos, as it helps to keep the skin moist and soft. |
| IUPAC Name | 1-(1-Hydroxypropoxy)propan-1-ol |
| Molecular Weight | 134.17 g/mol |
| Molecular Formula | C6H14O3 |
| Canonical SMILES | CCC(O)OC(CC)O |
| InChI | QYSXYAURTRCDJU-UHFFFAOYSA-N |
| InChI Key | InChI=1S/C6H14O3/c1-3-5(7)9-6(8)4-2/h5-8H,3-4H2,1-2H3 |
| Boiling Point | 90-95 °C 1mmHg |
| Melting Point | -32 °C |
| Flash Point | 137.8ºC |
| Density | 1.023 g/mL |
| Appearance | Dipropylene glycol is a clear, colorless, and odorless liquid at room temperature. |
| Application | 1. Use as a solvent: Dipropylene glycol is commonly used as an industrial solvent for paint and plastic industries due to its low toxicity, high boiling point, and good solubility. 2. Cosmetics: It is used as an ingredient in cosmetics and personal care products for its emollient properties and ability to improve the texture of products such as lotions, creams, and skin care products. 3. Food additives: Dipropylene glycol is used as a food and flavor additive and is known to enhance flavors and stabilize food products. 4. Antifreeze: Dipropylene glycol is used as an antifreeze and coolant in automotive and industrial applications due to its corrosion-resistant properties and low toxicity. 5. Humectant: It is used as a humectant in various products such as soaps, detergents, and textiles to prevent the material from drying out. 6. Fragrance carrier: Dipropylene glycol is used as a carrier for fragrances and is commonly used in air fresheners, perfumes, and other scented products. 7. Pharmaceutical applications: It is used in some pharmaceutical preparations as a diluent or solvent for various active ingredients. |
| Features And Benefits | 1. Moisturizes the skin 2. Enhances penetration of other ingredients 3. Stabilizes formulations 4. Prevents products from freezing 5. Reduces greasiness of formulations 6. Acts as a solvent for fragrances and essential oils. |
| HS Code | 29094990 |
| pH | 6-7 (100g/l, H2O, 20 °C) |
| Refractive Index | 1.445 |
| Topological Polar Surface Area | 49.7 Ų |
If you have any questions, please contact us. You will get a satisfactory answer.
