Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0083 |
| Product Name | Diosmine |
| CAS | 520-27-4 |
| Structure |  |
| Synonyms | Barosmin 3',5,7-Trihydroxy-4'-methoxyflavone 7-Rutinoside |
| IUPAC Name | 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
| Molecular Weight | 608.5 g/mol |
| Molecular Formula | C28H32O15 |
| InChI | InChI=1S/C28H32O15/c1-10-21(32)23(34)25(36)27(40-10)39-9-19-22(33)24(35)26(37)28(43-19)41-12-6-14(30)20-15(31)8-17(42-18(20)7-12)11-3-4-16(38-2)13(29)5-11/h3-8,10,19,21-30,32-37H,9H2,1-2H3/t10-,19+,21-,22+,23+,24-,25+,26+,27+,28+/m0/s1 |
| InChI Key | GZSOSUNBTXMUFQ-YFAPSIMESA-N |
| Boiling Point | 926.8±65.0 °C |
| Melting Point | 277-278 °C |
| Purity | 0.98 |
| Density | 1.68 g/mL |
| Appearance | Pale beige to brown solid |
| Isomeric SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC(=C(C=C5)OC)O)O)O)O)O)O)O)O |
If you have any questions, please contact us. You will get a satisfactory answer.
