Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0256 |
| Product Name | Dimethylol Ethylene Thiourea |
| CAS | 15534-95-9 |
| Structure |  |
| Synonyms | 1,3-Bis(hydroxymethyl)imidazolidine-2-thione;2-Imidazolidinethione, 1,3-bis(hydroxymethyl)- |
| IUPAC Name | 1,3-bis(hydroxymethyl)imidazolidine-2-thione |
| Molecular Weight | 162.21 g/mol |
| Molecular Formula | C5H10N2O2S |
| InChI | InChI=1S/C5H10N2O2S/c8-3-6-1-2-7(4-9)5(6)10/h8-9H,1-4H2 |
| InChI Key | QXYJLKUVMPXXKA-UHFFFAOYSA-N |
| Boiling Point | 440.6±38.0 °C |
| Purity | 95% |
| Density | 1.52 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1CN(C(=S)N1CO)CO |
If you have any questions, please contact us. You will get a satisfactory answer.
