Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-OT-0056 |
| Product Name | Dimethyldibenzylidene Sorbitol |
| CAS | 135861-56-2 |
| Structure |  |
| Synonyms | D-Glucitol, 1,3:2,4-bis-O-((3,4-dimethylphenyl)methylene)- |
| IUPAC Name | (1R)-1-[(4R,4aR,8aS)-2,6-bis(3,4-dimethylphenyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]ethane-1,2-diol |
| Molecular Weight | 414.5 g/mol |
| Molecular Formula | C24H30O6 |
| InChI | InChI=1S/C24H30O6/c1-13-5-7-17(9-15(13)3)23-27-12-20-22(30-23)21(19(26)11-25)29-24(28-20)18-8-6-14(2)16(4)10-18/h5-10,19-26H,11-12H2,1-4H3/t19-,20+,21-,22-,23?,24?/m1/s1 |
| InChI Key | YWEWWNPYDDHZDI-JJKKTNRVSA-N |
| Boiling Point | 611.6±50.0 °C |
| Melting Point | 275 °C |
| Purity | 95% |
| Density | 1.2 g/mL |
| Appearance | Solid |
| Isomeric SMILES | CC1=C(C=C(C=C1)C2OC[C@H]3[C@@H](O2)[C@H](OC(O3)C4=CC(=C(C=C4)C)C)[C@@H](CO)O)C |
| pKa | 13.26±0.20 |
If you have any questions, please contact us. You will get a satisfactory answer.
