Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0186 |
| Product Name | Dimethyl Oxazolidine |
| CAS | 51200-87-4 |
| Structure |  |
| Synonyms | Dimethyl oxazolidine;4,4-Dimethyl-1,3-oxazolidine |
| IUPAC Name | 4,4-dimethyl-1,3-oxazolidine |
| Molecular Weight | 101.15 g/mol |
| Molecular Formula | C5H11NO |
| InChI | InChI=1S/C5H11NO/c1-5(2)3-7-4-6-5/h6H,3-4H2,1-2H3 |
| InChI Key | GUQMDNQYMMRJPY-UHFFFAOYSA-N |
| Boiling Point | 189.55 °C |
| Purity | 75% |
| Density | 0.94 g/mL |
| Appearance | Liquid |
| Isomeric SMILES | CC1(COCN1)C |
| pKa | 8.41±0.40 |
If you have any questions, please contact us. You will get a satisfactory answer.
