Our customer service representatives are available 24 hours a day, from Monday to Sunday.
Catalog Number | CI-SC-1102 |
Product Name | Diisostearyl Fumarate |
CAS | 112385-09-8 |
Structure | |
Synonyms | 2-Butenedioic acid (2Z)-, diisooctadecyl ester |
IUPAC Name | bis(16-methylheptadecyl) (Z)-but-2-enedioate |
Molecular Weight | 621.03 g/mol |
Molecular Formula | C40H76O4 |
InChI | InChI=1S/C40H76O4/c1-37(2)31-27-23-19-15-11-7-5-9-13-17-21-25-29-35-43-39(41)33-34-40(42)44-36-30-26-22-18-14-10-6-8-12-16-20-24-28-32-38(3)4/h33-34,37-38H,5-32,35-36H2,1-4H3/b34-33- |
InChI Key | UNZOESWLBMZBEY-YHZPTAEISA-N |
Purity | 95% |
Appearance | Solid |
Highest Usage In Residency Products | 0.01 |
Highest Usage In Rinsing Products | 0.03 |
Isomeric SMILES | CC(C)CCCCCCCCCCCCCCCOC(=O)/C=C\C(=O)OCCCCCCCCCCCCCCCC(C)C |
What is the chemical formula for DIISOSTEARYL FUMARATE?
The chemical formula for DIISOSTEARYL FUMARATE is C40H76O4.
What is the molecular weight of DIISOSTEARYL FUMARATE?
The molecular weight of DIISOSTEARYL FUMARATE is 621.02904.
What are some synonyms for DIISOSTEARYL FUMARATE?
Some synonyms for DIISOSTEARYL FUMARATE are 2-Butenedioic acid (2Z)-, diisooctadecyl ester.
What is the CAS number for DIISOSTEARYL FUMARATE?
The CAS number for DIISOSTEARYL FUMARATE is 112385-09-8.
How many carbon atoms are present in DIISOSTEARYL FUMARATE?
There are 40 carbon atoms present in DIISOSTEARYL FUMARATE.
What type of compound is DIISOSTEARYL FUMARATE?
DIISOSTEARYL FUMARATE is an ester compound.
What is the appearance of DIISOSTEARYL FUMARATE?
DIISOSTEARYL FUMARATE is a white solid at room temperature.
What is the molecular structure of DIISOSTEARYL FUMARATE?
The molecular structure of DIISOSTEARYL FUMARATE is a diisooctadecyl ester of 2-Butenedioic acid.
How is DIISOSTEARYL FUMARATE commonly used?
DIISOSTEARYL FUMARATE is commonly used as an emollient and skin conditioning agent in cosmetics and personal care products.