Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0096 |
| Product Name | Diisopropyl Oxalate |
| CAS | 615-81-6 |
| Structure |  |
| Synonyms | Oxalic acid diisopropyl ester |
| IUPAC Name | dipropan-2-yl oxalate |
| Molecular Weight | 174.19 g/mol |
| Molecular Formula | C8H14O4 |
| InChI | InChI=1S/C8H14O4/c1-5(2)11-7(9)8(10)12-6(3)4/h5-6H,1-4H3 |
| InChI Key | ITHNIFCFNUZYLQ-UHFFFAOYSA-N |
| Boiling Point | 190 °C |
| Melting Point | -30 °C |
| Purity | 95% |
| Density | 1 g/mL |
| Appearance | Liquid |
| Isomeric SMILES | CC(C)OC(=O)C(=O)OC(C)C |
If you have any questions, please contact us. You will get a satisfactory answer.
