Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1213 |
| Product Name | Diisobutyl Adipate |
| CAS | 141-04-8 |
| Structure |  |
| Synonyms | Diisobutyl adipate;Diisobutyl hexanedioate;Hexanedioic acid, bis(2-methylpropyl) ester;Hexanedioic acid, diisobutyl ester |
| IUPAC Name | bis(2-methylpropyl) hexanedioate |
| Molecular Weight | 258.35 g/mol |
| Molecular Formula | C14H26O4 |
| InChI | InChI=1S/C14H26O4/c1-11(2)9-17-13(15)7-5-6-8-14(16)18-10-12(3)4/h11-12H,5-10H2,1-4H3 |
| InChI Key | RDOFJDLLWVCMRU-UHFFFAOYSA-N |
| Boiling Point | 293 °C |
| Melting Point | -17 °C |
| Purity | 95% |
| Density | 0.95 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.05 |
| Isomeric SMILES | CC(C)COC(=O)CCCCC(=O)OCC(C)C |
If you have any questions, please contact us. You will get a satisfactory answer.
