Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0288 |
| Product Name | 2,6-Dihydroxyethylaminotoluene |
| CAS | 149330-25-6 |
| Structure |  |
| Synonyms | Bis-2,6-N,N-(2-hydroxyethyl)diaminotoluene |
| IUPAC Name | 2-[3-(2-hydroxyethylamino)-2-methylanilino]ethanol |
| Molecular Weight | 210.27 g/mol |
| Molecular Formula | C11H18N2O2 |
| InChI | InChI=1S/C11H18N2O2/c1-9-10(12-5-7-14)3-2-4-11(9)13-6-8-15/h2-4,12-15H,5-8H2,1H3 |
| InChI Key | FGYCMSFOZIRDLN-UHFFFAOYSA-N |
| Boiling Point | 463.5±40.0 °C |
| Melting Point | 117 °C |
| Purity | 0.95 |
| Density | 1.22 g/mL |
| Appearance | White to light grey solid |
| Isomeric SMILES | CC1=C(C=CC=C1NCCO)NCCO |
If you have any questions, please contact us. You will get a satisfactory answer.
