Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0125 |
| Product Name | Dihydrolanosterol |
| CAS | 79-62-9 |
| Structure |  |
| Synonyms | (3beta)-Lanost-8-en-3-ol |
| IUPAC Name | (3S,5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Molecular Weight | 428.7 g/mol |
| Molecular Formula | C30H52O |
| InChI | InChI=1S/C30H52O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h20-22,25-26,31H,9-19H2,1-8H3/t21-,22-,25+,26+,28-,29-,30+/m1/s1 |
| InChI Key | MBZYKEVPFYHDOH-BQNIITSRSA-N |
| Boiling Point | 496.9±44.0 °C |
| Melting Point | 162 °C |
| Purity | 95% |
| Density | 0.97 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C[C@H](CCCC(C)C)[C@H]1CC[C@@]2([C@@]1(CCC3=C2CC[C@@H]4[C@@]3(CC[C@@H](C4(C)C)O)C)C)C |
If you have any questions, please contact us. You will get a satisfactory answer.
