Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1212 |
| Product Name | Dihydrocholesterol |
| CAS | 80-97-7 |
| Structure |  |
| Synonyms | 5-alpha-Cholestan-3-beta-ol |
| IUPAC Name | (3S,5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| Molecular Weight | 388.7 g/mol |
| Molecular Formula | C27H48O |
| InChI | InChI=1S/C27H48O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h18-25,28H,6-17H2,1-5H3/t19-,20+,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChI Key | QYIXCDOBOSTCEI-QCYZZNICSA-N |
| Boiling Point | 454.32 °C |
| Melting Point | 138-142 °C |
| Purity | 95% |
| Density | 0.95 g/mL |
| Solubility | Insoluble in water |
| Appearance | Solid |
| Isomeric SMILES | C[C@H](CCCC(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(CC[C@@H](C4)O)C)C |
If you have any questions, please contact us. You will get a satisfactory answer.
