Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-SC-1217 |
| Product Name | Diethyl Sebacate |
| CAS | 110-40-7 |
| Structure |  |
| Synonyms | Decanedioic acid, 1,1-diethyl ester;Decanedioic acid, diethyl ester;Sebacic acid, diethyl ester;FEMA No. 2376 |
| IUPAC Name | diethyl decanedioate |
| Molecular Weight | 258.35 g/mol |
| Molecular Formula | C14H26O4 |
| InChI | InChI=1S/C14H26O4/c1-3-17-13(15)11-9-7-5-6-8-10-12-14(16)18-4-2/h3-12H2,1-2H3 |
| InChI Key | ONKUXPIBXRRIDU-UHFFFAOYSA-N |
| Boiling Point | 312 °C |
| Melting Point | 1-2 °C |
| Purity | 95% |
| Density | 0.96 g/mL |
| Appearance | Liquid |
| Highest Usage In Residency Products | 0.02 |
| Highest Usage In Rinsing Products | 0.2132 |
| Isomeric SMILES | CCOC(=O)CCCCCCCCC(=O)OCC |
What is Diethyl Sebacate and what is its primary use in cosmetics?
Diethyl Sebacate is a colorless to yellowish liquid utilized primarily in the formulation of skincare and cosmetic products. Its main purpose in cosmetics is to enhance the penetration of active ingredients into the skin, thereby improving the overall hydration and effectiveness of the product.
Can Diethyl Sebacate be used as a fragrance?
Yes, Diethyl Sebacate can be used as a fragrance in cosmetic products. It possesses a faint but pleasant winey-fruity odor, which makes it a suitable component in fragrance formulations.
What are some additional applications of Diethyl Sebacate beyond cosmetics?
Aside from its cosmetic applications, Diethyl Sebacate can also function as a plasticizer, improving the mechanical properties such as strength and flexibility of polymers. Additionally, it serves as a solvent, aiding in the dissolution of poorly soluble substances.
Why is Diethyl Sebacate valued in skincare formulations?
Diethyl Sebacate is valued in skincare formulations due to its high polarity and excellent skin penetration properties. Its light texture allows for quick absorption without leaving a greasy residue, making it an ideal ingredient for improving skin hydration.
Are there any specific characteristics of Diethyl Sebacate that make it beneficial in product formulations?
Diethyl Sebacate is characterized by its light texture and quick absorption, which contribute to its effectiveness in enhancing skin hydration. Its high polarity and excellent skin penetration capabilities further increase its utility in facilitating the delivery of active ingredients to the skin.
If you have any questions, please contact us. You will get a satisfactory answer.
