Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0208 |
| Product Name | Dichlorobenzyl Alcohol |
| CAS | 1777-82-8 |
| Structure |  |
| Synonyms | 2,4-Dichlorobenzyl alcohol;Benzenemethanol, 2,4-dichloro-;Benzyl alcohol, 2,4-dichloro-;Dichlorobenzyl alcohol |
| IUPAC Name | (2,4-dichlorophenyl)methanol |
| Molecular Weight | 177.02 g/mol |
| Molecular Formula | C7H6Cl2O |
| InChI | InChI=1S/C7H6Cl2O/c8-6-2-1-5(4-10)7(9)3-6/h1-3,10H,4H2 |
| InChI Key | DBHODFSFBXJZNY-UHFFFAOYSA-N |
| Boiling Point | 150 °C / 25mmHg |
| Melting Point | 55-58 °C |
| Purity | 95% |
| Density | 1.29 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1=CC(=C(C=C1Cl)Cl)CO |
If you have any questions, please contact us. You will get a satisfactory answer.
