Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-GU-0080 |
| Product Name | Diammonium EDTA |
| CAS | 20824-56-0 |
| Structure |  |
| Synonyms | 2Nh4(EdtaNh4) |
| IUPAC Name | diazanium;2-[2-[carboxylatomethyl(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetate |
| Molecular Weight | 326.3 g/mol |
| Molecular Formula | C10H22N4O8 |
| InChI | InChI=1S/C10H16N2O8.2H3N/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);2*1H3 |
| InChI Key | KYQODXQIAJFKPH-UHFFFAOYSA-N |
| Melting Point | 215-217 °C |
| Purity | 0.98 |
| Density | 1.483 g/mL |
| Appearance | Solid |
| Highest Usage In Residency Products | 0.0005 |
| Highest Usage In Rinsing Products | 0.01 |
| Isomeric SMILES | C(CN(CC(=O)O)CC(=O)[O-])N(CC(=O)O)CC(=O)[O-].[NH4+].[NH4+] |
If you have any questions, please contact us. You will get a satisfactory answer.
