Our customer service representatives are available 24 hours a day, from Monday to Sunday.
| Catalog Number | CI-HC-0313 |
| Product Name | 2,6-Diaminopyridine |
| CAS | 141-86-6 |
| Structure |  |
| Synonyms | 2,6-Pyridinediamine;Pyridine, 2,6-diamino-;Pyridine-2,6-diyldiamine |
| IUPAC Name | pyridine-2,6-diamine |
| Molecular Weight | 109.13 g/mol |
| Molecular Formula | C5H7N3 |
| InChI | InChI=1S/C5H7N3/c6-4-2-1-3-5(7)8-4/h1-3H,(H4,6,7,8) |
| InChI Key | VHNQIURBCCNWDN-UHFFFAOYSA-N |
| Boiling Point | 285 °C |
| Melting Point | 117-122 °C |
| Flash Point | 155°C |
| Purity | 95% |
| Density | 1.71 g/mL |
| Appearance | Solid |
| Isomeric SMILES | C1=CC(=NC(=C1)N)N |
| pKa | 6.13±0.24 |
If you have any questions, please contact us. You will get a satisfactory answer.
